EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22ClNO4 |
| Net Charge | 0 |
| Average Mass | 387.863 |
| Monoisotopic Mass | 387.12374 |
| SMILES | COc1ccc(/C(=C\C(=O)N2CCOCC2)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H22ClNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3/b18-14- |
| InChIKey | QNBTYORWCCMPQP-JXAWBTAJSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-dimethomorph (CHEBI:83427) is a aromatic ether (CHEBI:35618) |
| (Z)-dimethomorph (CHEBI:83427) is a enamide (CHEBI:51751) |
| (Z)-dimethomorph (CHEBI:83427) is a monochlorobenzenes (CHEBI:83403) |
| (Z)-dimethomorph (CHEBI:83427) is a morpholine fungicide (CHEBI:87134) |
| (Z)-dimethomorph (CHEBI:83427) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| dimethomorph (CHEBI:81848) has part (Z)-dimethomorph (CHEBI:83427) |
| Synonyms | Source |
|---|---|
| (2Z)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(morpholin-4-yl)prop-2-en-1-one | ChEBI |
| Dimethomorph Z | ChEBI |
| Z-Dimethomorph | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343579 | Reaxys |
| CAS:113210-98-3 | ChemIDplus |
| Citations |
|---|