EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22ClNO4 |
| Net Charge | 0 |
| Average Mass | 387.863 |
| Monoisotopic Mass | 387.12374 |
| SMILES | [H]C(C(=O)N1CCOCC1)=C(c1ccc(Cl)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22ClNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | QNBTYORWCCMPQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethomorph (CHEBI:81848) has part (E)-dimethomorph (CHEBI:83426) |
| dimethomorph (CHEBI:81848) has part (Z)-dimethomorph (CHEBI:83427) |
| dimethomorph (CHEBI:81848) has role antifungal agrochemical (CHEBI:86328) |
| dimethomorph (CHEBI:81848) has role environmental contaminant (CHEBI:78298) |
| dimethomorph (CHEBI:81848) has role xenobiotic (CHEBI:35703) |
| dimethomorph (CHEBI:81848) is a mixture (CHEBI:60004) |
| dimethomorph (CHEBI:81848) is a morpholine fungicide (CHEBI:87134) |
| IUPAC Name |
|---|
| (2Ξ)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(morpholin-4-yl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl)morpholine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 245 | PPDB |
| C18583 | KEGG COMPOUND |
| dimethomorph | Alan Wood's Pesticides |
| EP294907 | Patent |
| US4933449 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8396839 | Reaxys |
| CAS:110488-70-5 | KEGG COMPOUND |
| CAS:110488-70-5 | ChemIDplus |
| Citations |
|---|