EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N4 |
| Net Charge | 0 |
| Average Mass | 310.360 |
| Monoisotopic Mass | 310.12185 |
| SMILES | C1=Cc2cc3ccc(cc4nc(cc5ccc(cc1n2)n5)C=C4)n3 |
| InChI | InChI=1S/C20H14N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12,21,24H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | RKCAIXNGYQCCAL-CEVVSZFKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| porphyrin (CHEBI:8337) has role metabolite (CHEBI:25212) |
| porphyrin (CHEBI:8337) is a porphyrins (CHEBI:26214) |
| porphyrin (CHEBI:8337) is a tetrapyrrole fundamental parent (CHEBI:35794) |
| Incoming Relation(s) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has parent hydride porphyrin (CHEBI:8337) |
| IUPAC Name |
|---|
| porphyrin |
| Synonyms | Source |
|---|---|
| 21H,23H-Porphin | NIST Chemistry WebBook |
| 21H,23H-porphine | NIST Chemistry WebBook |
| porphine | ChemIDplus |
| Porphyrin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05113 | KEGG COMPOUND |
| HMDB0000839 | HMDB |
| Porphyrin | Wikipedia |
| Citations |
|---|