EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H38N8 |
| Net Charge | +4 |
| Average Mass | 678.844 |
| Monoisotopic Mass | 678.31975 |
| SMILES | C[n+]1ccc(-c2c3ccc(n3)c(-c3cc[n+](C)cc3)c3nc(c(-c4cc[n+](C)cc4)c4ccc(n4)c(-c4cc[n+](C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H37N8/c1-49-21-13-29(14-22-49)41-33-5-7-35(45-33)42(30-15-23-50(2)24-16-30)37-9-11-39(47-37)44(32-19-27-52(4)28-20-32)40-12-10-38(48-40)43(36-8-6-34(41)46-36)31-17-25-51(3)26-18-31/h5-28H,1-4H3,(H,45,46,47,48)/q+3/p+1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | ABCGFHPGHXSVKI-LWQDQPMZSA-O |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has parent hydride porphyrin (CHEBI:8337) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has role angiogenesis inhibitor (CHEBI:48422) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has role antineoplastic agent (CHEBI:35610) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) has role photosensitizing agent (CHEBI:47868) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| meso-tetrakis(N-methyl-4-pyridyl)porphine tetrakis(p-toluenesulfonate) (CHEBI:78039) has part meso-tetrakis(N-methyl-4-pyridyl)porphine(4+) (CHEBI:37447) |
| IUPAC Names |
|---|
| 5,10,15,20-tetrakis(1-methylpyridinium-4-yl)porphyrin |
| 4,4',4'',4'''-porphyrin-5,10,15,20-tetrayltetrakis(1-methylpyridinium) |
| Synonyms | Source |
|---|---|
| tetra(4-N-methylpyridyl)porphine | ChEBI |
| meso-Tetrakis(2-N-methylpyridyl)porphine | ChemIDplus |
| Tetrakis(N-methyl-4-pyridino)porphine | ChemIDplus |
| meso-Tetrakis(N-methyl-4-pyridinium)phenyl porphyrin | ChemIDplus |
| Mesotetra(4-N-methylpyridyl)porphine | ChemIDplus |
| meso-tetrakis(N-methyl-4-pyridyl)porphine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:87183 | Gmelin |
| Reaxys:3586693 | Reaxys |
| CAS:38673-65-3 | ChemIDplus |
| Citations |
|---|