EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO3 |
| Net Charge | +1 |
| Average Mass | 212.269 |
| Monoisotopic Mass | 212.12812 |
| SMILES | CC(C)[NH2+]C[C@H](O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | LMOINURANNBYCM-NSHDSACASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-orciprenaline(1+) (CHEBI:83340) is a ammonium ion derivative (CHEBI:35274) |
| (R)-orciprenaline(1+) (CHEBI:83340) is a organic cation (CHEBI:25697) |
| (R)-orciprenaline(1+) (CHEBI:83340) is conjugate acid of (R)-orciprenaline (CHEBI:83330) |
| (R)-orciprenaline(1+) (CHEBI:83340) is enantiomer of (S)-orciprenaline(1+) (CHEBI:83338) |
| Incoming Relation(s) |
| (R)-orciprenaline sulfate (CHEBI:83333) has part (R)-orciprenaline(1+) (CHEBI:83340) |
| (R)-orciprenaline (CHEBI:83330) is conjugate base of (R)-orciprenaline(1+) (CHEBI:83340) |
| (S)-orciprenaline(1+) (CHEBI:83338) is enantiomer of (R)-orciprenaline(1+) (CHEBI:83340) |
| IUPAC Name |
|---|
| N-[(2R)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]propan-2-aminium |