EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO3 |
| Net Charge | 0 |
| Average Mass | 211.261 |
| Monoisotopic Mass | 211.12084 |
| SMILES | CC(C)NC[C@H](O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8/h3-5,7,11-15H,6H2,1-2H3/t11-/m0/s1 |
| InChIKey | LMOINURANNBYCM-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-orciprenaline (CHEBI:83330) is a 5-[1-hydroxy-2-(isopropanylamino)ethyl]benzene-1,3-diol (CHEBI:83329) |
| (R)-orciprenaline (CHEBI:83330) is conjugate base of (R)-orciprenaline(1+) (CHEBI:83340) |
| (R)-orciprenaline (CHEBI:83330) is enantiomer of (S)-orciprenaline (CHEBI:83331) |
| Incoming Relation(s) |
| orciprenaline (CHEBI:82719) has part (R)-orciprenaline (CHEBI:83330) |
| (R)-orciprenaline(1+) (CHEBI:83340) is conjugate acid of (R)-orciprenaline (CHEBI:83330) |
| (S)-orciprenaline (CHEBI:83331) is enantiomer of (R)-orciprenaline (CHEBI:83330) |
| IUPAC Name |
|---|
| 5-[(1R)-1-hydroxy-2-(isopropylamino)ethyl]benzene-1,3-diol |