EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34FN2O4 |
| Net Charge | +1 |
| Average Mass | 493.599 |
| Monoisotopic Mass | 493.24971 |
| SMILES | [H][C@@]12C[C@H](NC(=O)OCC)CC[C@@]1([H])[C@H](/C=C/c1ccc(-c3cccc(F)c3)c[nH+]1)[C@]1([H])[C@@H](C)OC(=O)[C@]1([H])C2 |
| InChI | InChI=1S/C29H33FN2O4/c1-3-35-29(34)32-23-10-11-24-20(14-23)15-26-27(17(2)36-28(26)33)25(24)12-9-22-8-7-19(16-31-22)18-5-4-6-21(30)13-18/h4-9,12-13,16-17,20,23-27H,3,10-11,14-15H2,1-2H3,(H,32,34)/p+1/b12-9+/t17-,20+,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | ZBGXUVOIWDMMJE-QHNZEKIYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorapaxar(1+) (CHEBI:83315) is a pyridinium ion (CHEBI:50334) |
| vorapaxar(1+) (CHEBI:83315) is conjugate acid of vorapaxar (CHEBI:82702) |
| Incoming Relation(s) |
| vorapaxar sulfate (CHEBI:83314) has part vorapaxar(1+) (CHEBI:83315) |
| vorapaxar (CHEBI:82702) is conjugate base of vorapaxar(1+) (CHEBI:83315) |
| IUPAC Name |
|---|
| 2-[(E)-2-{(3R,3aS,4S,4aR,7R,8aR,9aR)-7-[(ethoxycarbonyl)amino]-3-methyl-1-oxododecahydronaphtho[2,3-c]furan-4-yl}ethenyl]-5-(3-fluorophenyl)pyridinium |