EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33FN2O4.H2O4S |
| Net Charge | 0 |
| Average Mass | 590.670 |
| Monoisotopic Mass | 590.20982 |
| SMILES | O=S(=O)(O)O.[H][C@@]12C[C@H](NC(=O)OCC)CC[C@@]1([H])[C@H](/C=C/c1ccc(-c3cccc(F)c3)cn1)[C@]1([H])[C@@H](C)OC(=O)[C@]1([H])C2 |
| InChI | InChI=1S/C29H33FN2O4.H2O4S/c1-3-35-29(34)32-23-10-11-24-20(14-23)15-26-27(17(2)36-28(26)33)25(24)12-9-22-8-7-19(16-31-22)18-5-4-6-21(30)13-18;1-5(2,3)4/h4-9,12-13,16-17,20,23-27H,3,10-11,14-15H2,1-2H3,(H,32,34);(H2,1,2,3,4)/b12-9+;/t17-,20+,23-,24-,25+,26-,27+;/m1./s1 |
| InChIKey | NQRYCIGCIAWEIC-CKLVGUEFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | protease-activated receptor-1 antagonist An antagonist at the protease-activated receptor-1. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorapaxar sulfate (CHEBI:83314) has part vorapaxar(1+) (CHEBI:83315) |
| vorapaxar sulfate (CHEBI:83314) has role cardiovascular drug (CHEBI:35554) |
| vorapaxar sulfate (CHEBI:83314) has role platelet aggregation inhibitor (CHEBI:50427) |
| vorapaxar sulfate (CHEBI:83314) has role protease-activated receptor-1 antagonist (CHEBI:83313) |
| vorapaxar sulfate (CHEBI:83314) is a organic sulfate salt (CHEBI:51337) |
| IUPAC Names |
|---|
| 2-[(E)-2-{(3R,3aS,4S,4aR,7R,8aR,9aR)-7-[(ethoxycarbonyl)amino]-3-methyl-1-oxododecahydronaphtho[2,3-c]furan-4-yl}ethenyl]-5-(3-fluorophenyl)pyridinium hydrogen sulfate |
| ethyl [(1R,3aR,4aR,6R,8aR,9S,9aS)-9-{(E)-2-[5-(3-fluorophenyl)pyridin-2-yl]ethenyl}-1-methyl-3-oxododecahydronaphtho[2,3-c]furan-6-yl]carbamate sulfate |
| Synonyms | Source |
|---|---|
| Sch 530348 | ChemIDplus |
| vorapaxar monosulfate | ChEBI |
| Brand Name | Source |
|---|---|
| ZONTIVITY | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12646217 | Reaxys |
| CAS:705260-08-8 | ChemIDplus |
| Citations |
|---|