EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23O3 |
| Net Charge | -1 |
| Average Mass | 251.346 |
| Monoisotopic Mass | 251.16527 |
| SMILES | C/C(=C\C(=O)[O-])CC/C=C(\C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C15H24O3/c1-11(8-9-13-15(3,4)18-13)6-5-7-12(2)10-14(16)17/h6,10,13H,5,7-9H2,1-4H3,(H,16,17)/p-1/b11-6+,12-10+/t13-/m1/s1 |
| InChIKey | DIAZNFMKLJLDNM-AQAKBEBOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone III carboxylate (CHEBI:83274) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| juvenile hormone III carboxylate (CHEBI:83274) is conjugate base of juvenile hormone III acid (CHEBI:80536) |
| Incoming Relation(s) |
| juvenile hormone III acid (CHEBI:80536) is conjugate acid of juvenile hormone III carboxylate (CHEBI:83274) |
| IUPAC Name |
|---|
| (2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate |
| UniProt Name | Source |
|---|---|
| juvenile hormone III carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12750 | MetaCyc |