EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80536 - juvenile hormone III acid
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | C/C(=C\C(=O)O)CC/C=C(\C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C15H24O3/c1-11(8-9-13-15(3,4)18-13)6-5-7-12(2)10-14(16)17/h6,10,13H,5,7-9H2,1-4H3,(H,16,17)/b11-6+,12-10+/t13-/m1/s1 |
| InChIKey | DIAZNFMKLJLDNM-AQAKBEBOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone III acid (CHEBI:80536) is a branched-chain fatty acid (CHEBI:35819) |
| juvenile hormone III acid (CHEBI:80536) is a epoxy fatty acid (CHEBI:61498) |
| juvenile hormone III acid (CHEBI:80536) is a juvenile hormone (CHEBI:24943) |
| juvenile hormone III acid (CHEBI:80536) is a olefinic fatty acid (CHEBI:53339) |
| juvenile hormone III acid (CHEBI:80536) is a polyunsaturated fatty acid (CHEBI:26208) |
| juvenile hormone III acid (CHEBI:80536) is conjugate acid of juvenile hormone III carboxylate (CHEBI:83274) |
| Incoming Relation(s) |
| juvenile hormone III carboxylate (CHEBI:83274) is conjugate base of juvenile hormone III acid (CHEBI:80536) |
| IUPAC Name |
|---|
| (2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoic acid |
| Synonym | Source |
|---|---|
| (2E,6E)-(R)-10,11-epoxy-3,7,11-trimethyldodeca-2,6-dienoic acid | ChEBI |
| Citations |
|---|