EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O2 |
| Net Charge | 0 |
| Average Mass | 348.446 |
| Monoisotopic Mass | 348.18378 |
| SMILES | Cc1ccc(/C(=C\CN2CCCC2)c2cccc(/C=C/C(=O)O)n2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+ |
| InChIKey | PWACSDKDOHSSQD-IUTFFREVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acrivastine (CHEBI:83168) has role H1-receptor antagonist (CHEBI:37955) |
| acrivastine (CHEBI:83168) is a N-alkylpyrrolidine (CHEBI:46775) |
| acrivastine (CHEBI:83168) is a olefinic compound (CHEBI:78840) |
| acrivastine (CHEBI:83168) is a pyridines (CHEBI:26421) |
| acrivastine (CHEBI:83168) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-3-{6-[(1E)-1-(4-methylphenyl)-3-(pyrrolidin-1-yl)prop-1-en-1-yl]pyridin-2-yl}acrylic acid |
| INNs | Source |
|---|---|
| acrivastina | ChemIDplus |
| acrivastine | KEGG DRUG |
| acrivastine | ChemIDplus |
| acrivastinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| BW 825C | ChemIDplus |
| BW A825C | ChemIDplus |
| (E)-6-((E)-3-(1-Pyrrolidinyl)-1-p-tolylpropenyl)-2-pyridineacrylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 82 | DrugCentral |
| Acrivastine | Wikipedia |
| D02760 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6739893 | Reaxys |
| CAS:87848-99-5 | ChemIDplus |
| CAS:87848-99-5 | KEGG DRUG |
| Citations |
|---|