EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O4S |
| Net Charge | 0 |
| Average Mass | 250.360 |
| Monoisotopic Mass | 250.12388 |
| SMILES | CCCCC/C=C/[C@@H](C)CCOS(=O)(=O)O |
| InChI | InChI=1S/C11H22O4S/c1-3-4-5-6-7-8-11(2)9-10-15-16(12,13)14/h7-8,11H,3-6,9-10H2,1-2H3,(H,12,13,14)/b8-7+/t11-/m1/s1 |
| InChIKey | QNUMXENJPAUAPZ-WSKFYRRCSA-N |
| Roles Classification |
|---|
| Biological Roles: | kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) has role kairomone (CHEBI:83074) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) is a organic sulfate (CHEBI:25704) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) is a sulfuric ester (CHEBI:26819) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) is conjugate acid of (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) |
| Incoming Relation(s) |
| (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) is conjugate base of (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) |
| IUPAC Name |
|---|
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate |