EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21O4S |
| Net Charge | -1 |
| Average Mass | 249.352 |
| Monoisotopic Mass | 249.11660 |
| SMILES | CCCCC/C=C/[C@@H](C)CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H22O4S/c1-3-4-5-6-7-8-11(2)9-10-15-16(12,13)14/h7-8,11H,3-6,9-10H2,1-2H3,(H,12,13,14)/p-1/b8-7+/t11-/m1/s1 |
| InChIKey | QNUMXENJPAUAPZ-WSKFYRRCSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation and Absolute Configuration Determination of Aliphatic Sulfates as the Daphnia Kairomones Inducing Morphological Defense of a Phytoplankton-Part 2Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI, Takenori KUSUMI, and Takashi OOIChem. Pharm. Bull. 56(1) 129-132 (2008)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) has role kairomone (CHEBI:83074) |
| (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) is a organosulfate oxoanion (CHEBI:58958) |
| (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) is conjugate base of (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) |
| Incoming Relation(s) |
| (3S,4E)-3-methyldec-4-en-1-yl hydrogen sulfate (CHEBI:83114) is conjugate acid of (3S,4E)-3-methyldec-4-en-1-yl sulfate (CHEBI:83015) |
| IUPAC Name |
|---|
| (3S,4E)-3-methyldec-4-en-1-yl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15883653 | Reaxys |
| Citations |
|---|