EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H24O4S |
| Net Charge | 0 |
| Average Mass | 252.376 |
| Monoisotopic Mass | 252.13953 |
| SMILES | CC(C)CCC[C@@H](C)CCCOS(=O)(=O)O |
| InChI | InChI=1S/C11H24O4S/c1-10(2)6-4-7-11(3)8-5-9-15-16(12,13)14/h10-11H,4-9H2,1-3H3,(H,12,13,14)/t11-/m1/s1 |
| InChIKey | FCHHMBXKFHPMFQ-LLVKDONJSA-N |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) has role Daphnia pulex metabolite (CHEBI:83075) |
| (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) has role kairomone (CHEBI:83074) |
| (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) is a alkyl sulfate (CHEBI:29281) |
| (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) is conjugate acid of (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) |
| Incoming Relation(s) |
| (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) is conjugate base of (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) |
| IUPAC Name |
|---|
| (4R)-4,8-dimethylnonyl hydrogen sulfate |