EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83014 - (4R)-4,8-dimethylnonyl sulfate
| Formula | C11H23O4S |
| Net Charge | -1 |
| Average Mass | 251.368 |
| Monoisotopic Mass | 251.13225 |
| SMILES | CC(C)CCC[C@@H](C)CCCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H24O4S/c1-10(2)6-4-7-11(3)8-5-9-15-16(12,13)14/h10-11H,4-9H2,1-3H3,(H,12,13,14)/p-1/t11-/m1/s1 |
| InChIKey | FCHHMBXKFHPMFQ-LLVKDONJSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation and Absolute Configuration Determination of Aliphatic Sulfates as the Daphnia Kairomones Inducing Morphological Defense of a Phytoplankton-Part 2Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI, Takenori KUSUMI, and Takashi OOIChem. Pharm. Bull. 56(1) 129-132 (2008)\fs22) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) has role Daphnia pulex metabolite (CHEBI:83075) |
| (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) has role kairomone (CHEBI:83074) |
| (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) is a organosulfate oxoanion (CHEBI:58958) |
| (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) is conjugate base of (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) |
| Incoming Relation(s) |
| (4R)-4,8-dimethylnonyl hydrogen sulfate (CHEBI:83112) is conjugate acid of (4R)-4,8-dimethylnonyl sulfate (CHEBI:83014) |
| IUPAC Name |
|---|
| (4R)-4,8-dimethylnonyl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15883652 | Reaxys |
| Citations |
|---|