EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O4S |
| Net Charge | 0 |
| Average Mass | 264.387 |
| Monoisotopic Mass | 264.13953 |
| SMILES | CCCCCCCC/C=C\CCOS(=O)(=O)O |
| InChI | InChI=1S/C12H24O4S/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15/h9-10H,2-8,11-12H2,1H3,(H,13,14,15)/b10-9- |
| InChIKey | OXZPGZPXSCUIQZ-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) has role kairomone (CHEBI:83074) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) is a organic sulfate (CHEBI:25704) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) is a sulfuric ester (CHEBI:26819) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) is conjugate acid of (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) |
| Incoming Relation(s) |
| (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) is conjugate base of (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) |
| IUPAC Name |
|---|
| (3Z)-dodec-3-en-1-yl hydrogen sulfate |