EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O4S |
| Net Charge | -1 |
| Average Mass | 263.379 |
| Monoisotopic Mass | 263.13225 |
| SMILES | CCCCCCCC/C=C\CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H24O4S/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15/h9-10H,2-8,11-12H2,1H3,(H,13,14,15)/p-1/b10-9- |
| InChIKey | OXZPGZPXSCUIQZ-KTKRTIGZSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation of New Aliphatic Sulfates and Sulfamate as the Daphnia Kairomones Inducing Morphological Change of a Phytoplankton Scenedesmus gutwinskii Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI,Takenori KUSUMI, and Takashi OOI Chem. Pharm. Bull. 56(1) 133-136 (2008)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) has role kairomone (CHEBI:83074) |
| (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) is a organosulfate oxoanion (CHEBI:58958) |
| (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) is conjugate base of (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) |
| Incoming Relation(s) |
| (3Z)-dodec-3-en-1-yl hydrogen sulfate (CHEBI:83083) is conjugate acid of (3Z)-dodec-3-en-1-yl sulfate (CHEBI:82995) |
| IUPAC Name |
|---|
| (3Z)-dodec-3-en-1-yl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15864356 | Reaxys |
| Citations |
|---|