EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O7 |
| Net Charge | 0 |
| Average Mass | 290.272 |
| Monoisotopic Mass | 290.11140 |
| SMILES | NC(=O)CC[C@@H]1NCC2(OC[C@@H](O)[C@@H](O)[C@@H]2O)OC1=O |
| InChI | InChI=1S/C11H18N2O7/c12-7(15)2-1-5-10(18)20-11(4-13-5)9(17)8(16)6(14)3-19-11/h5-6,8-9,13-14,16-17H,1-4H2,(H2,12,15)/t5-,6+,8+,9-,11?/m0/s1 |
| InChIKey | KPXUNMNRHZUNAN-NNBAOJFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysanthemum (ncbitaxon:13422) | root (BTO:0001188) | DOI (10.1016/0031-9422(93)00283-L) | Found in crown gall tumours induced by the soil bacterium Agrobacterium tumefaciens |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysopine (CHEBI:83079) has functional parent D-fructopyranose (CHEBI:37714) |
| chrysopine (CHEBI:83079) has functional parent L-glutamine (CHEBI:18050) |
| chrysopine (CHEBI:83079) has role plant metabolite (CHEBI:76924) |
| chrysopine (CHEBI:83079) is a amino acid opine (CHEBI:83229) |
| chrysopine (CHEBI:83079) is a carboxamide (CHEBI:37622) |
| chrysopine (CHEBI:83079) is a secondary amino compound (CHEBI:50995) |
| chrysopine (CHEBI:83079) is a spiroketal (CHEBI:72600) |
| chrysopine (CHEBI:83079) is a triol (CHEBI:27136) |
| chrysopine (CHEBI:83079) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| α-chrysopine (CHEBI:83080) is a chrysopine (CHEBI:83079) |
| β-chrysopine (CHEBI:83081) is a chrysopine (CHEBI:83079) |
| IUPAC Name |
|---|
| 3-[(3S,9R,10R,11S)-9,10,11-trihydroxy-2-oxo-1,7-dioxa-4-azaspiro[5.5]undec-3-yl]propanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7384218 | Reaxys |
| Citations |
|---|