EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OCC1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha122h-2x_2-6]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6?/m1/s1 |
| InChIKey | LKDRXBCSQODPBY-VRPWFDPXSA-N |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-fructopyranose (CHEBI:37714) has role sweetening agent (CHEBI:50505) |
| D-fructopyranose (CHEBI:37714) is a D-fructose (CHEBI:15824) |
| D-fructopyranose (CHEBI:37714) is a cyclic hemiketal (CHEBI:59780) |
| D-fructopyranose (CHEBI:37714) is a fructopyranose (CHEBI:28614) |
| Incoming Relation(s) |
| D-fructopyranose 1-phosphate (CHEBI:37516) has functional parent D-fructopyranose (CHEBI:37714) |
| chrysopine (CHEBI:83079) has functional parent D-fructopyranose (CHEBI:37714) |
| α-D-fructopyranose (CHEBI:37719) is a D-fructopyranose (CHEBI:37714) |
| β-D-fructopyranose (CHEBI:41005) is a D-fructopyranose (CHEBI:37714) |
| IUPAC Name |
|---|
| D-fructopyranose |
| UniProt Name | Source |
|---|---|
| D-fructopyranose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1252 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Gmelin:102547 | Gmelin |
| Reaxys:1907319 | Reaxys |
| Citations |
|---|