EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31O2 |
| Net Charge | -1 |
| Average Mass | 279.444 |
| Monoisotopic Mass | 279.23295 |
| SMILES | CCCCC/C=C\C=C/CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-9H,2-5,10-17H2,1H3,(H,19,20)/p-1/b7-6-,9-8- |
| InChIKey | GKJZMAHZJGSBKD-JPDBVBESSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihomolinoleate (CHEBI:83066) has role human metabolite (CHEBI:77746) |
| dihomolinoleate (CHEBI:83066) has role plant metabolite (CHEBI:76924) |
| dihomolinoleate (CHEBI:83066) is a octadecadienoate (CHEBI:25626) |
| dihomolinoleate (CHEBI:83066) is conjugate base of dihomolinoleic acid (CHEBI:83063) |
| Incoming Relation(s) |
| dihomolinoleic acid (CHEBI:83063) is conjugate acid of dihomolinoleate (CHEBI:83066) |
| IUPAC Name |
|---|
| (10Z,12Z)-octadeca-10,12-dienoate |
| Synonym | Source |
|---|---|
| dihomo-linoleate (20:2n6) | ChEBI |