EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83063 - dihomolinoleic acid
| Formula | C18H32O2 |
| Net Charge | 0 |
| Average Mass | 280.452 |
| Monoisotopic Mass | 280.24023 |
| SMILES | CCCCC/C=C\C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-9H,2-5,10-17H2,1H3,(H,19,20)/b7-6-,9-8- |
| InChIKey | GKJZMAHZJGSBKD-JPDBVBESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nigella sativa (ncbitaxon:555479) | - | Article (Journal of the science of food and agriculture 86, 871-876) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihomolinoleic acid (CHEBI:83063) has role human metabolite (CHEBI:77746) |
| dihomolinoleic acid (CHEBI:83063) has role plant metabolite (CHEBI:76924) |
| dihomolinoleic acid (CHEBI:83063) is a octadecadienoic acid (CHEBI:25627) |
| dihomolinoleic acid (CHEBI:83063) is conjugate acid of dihomolinoleate (CHEBI:83066) |
| Incoming Relation(s) |
| 1-octadecanoyl-2-[(10Z,12Z)-octadecadienoyl]-sn-glycero-3-phosphocholine (CHEBI:84819) has functional parent dihomolinoleic acid (CHEBI:83063) |
| dihomolinoleate (CHEBI:83066) is conjugate base of dihomolinoleic acid (CHEBI:83063) |
| IUPAC Name |
|---|
| (10Z,12Z)-octadeca-10,12-dienoic acid |
| Synonyms | Source |
|---|---|
| cis-10,cis-12-octadecadienoic acid | ChEBI |
| 20:2n6 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726561 | Reaxys |
| Citations |
|---|