EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35O2 |
| Net Charge | -1 |
| Average Mass | 295.487 |
| Monoisotopic Mass | 295.26425 |
| SMILES | [H]C(=CCCCCCCCCC(=O)[O-])CCCCCCCC |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h9-10H,2-8,11-18H2,1H3,(H,20,21)/p-1 |
| InChIKey | BBOWBNGUEWHNQZ-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-nonadecenoate (CHEBI:83052) has role human metabolite (CHEBI:77746) |
| 10-nonadecenoate (CHEBI:83052) is a long-chain fatty acid anion (CHEBI:57560) |
| 10-nonadecenoate (CHEBI:83052) is a monounsaturated fatty acid anion (CHEBI:82680) |
| 10-nonadecenoate (CHEBI:83052) is a straight-chain fatty acid anion (CHEBI:59203) |
| 10-nonadecenoate (CHEBI:83052) is conjugate base of 10-nonadecenoic acid (CHEBI:83050) |
| Incoming Relation(s) |
| 10-nonadecenoic acid (CHEBI:83050) is conjugate acid of 10-nonadecenoate (CHEBI:83052) |
| Synonym | Source |
|---|---|
| nonadec-10-enoate | ChEBI |