EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O2 |
| Net Charge | 0 |
| Average Mass | 296.495 |
| Monoisotopic Mass | 296.27153 |
| SMILES | [H]C(=CCCCCCCCCC(=O)O)CCCCCCCC |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h9-10H,2-8,11-18H2,1H3,(H,20,21) |
| InChIKey | BBOWBNGUEWHNQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21359215 ) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-nonadecenoic acid (CHEBI:83050) has role human metabolite (CHEBI:77746) |
| 10-nonadecenoic acid (CHEBI:83050) is a long-chain fatty acid (CHEBI:15904) |
| 10-nonadecenoic acid (CHEBI:83050) is a monounsaturated fatty acid (CHEBI:25413) |
| 10-nonadecenoic acid (CHEBI:83050) is a straight-chain fatty acid (CHEBI:59202) |
| 10-nonadecenoic acid (CHEBI:83050) is conjugate acid of 10-nonadecenoate (CHEBI:83052) |
| Incoming Relation(s) |
| (10Z)-nonadec-10-enoic acid (CHEBI:83051) is a 10-nonadecenoic acid (CHEBI:83050) |
| 10-nonadecenoate (CHEBI:83052) is conjugate base of 10-nonadecenoic acid (CHEBI:83050) |
| IUPAC Name |
|---|
| nonadec-10-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8159158 | Reaxys |
| Citations |
|---|