EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | [H]C(=CCCCCCC)CCCC(=O)O |
| InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h7-8H,2-6,9-11H2,1H3,(H,13,14) |
| InChIKey | IJBFSOLHRKELLR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7586519) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-dodecenoic acid (CHEBI:83044) has role human metabolite (CHEBI:77746) |
| 5-dodecenoic acid (CHEBI:83044) is a dodecenoic acid (CHEBI:23867) |
| 5-dodecenoic acid (CHEBI:83044) is conjugate acid of 5-dodecenoate (CHEBI:83046) |
| Incoming Relation(s) |
| cis-5-dodecenoic acid (CHEBI:86595) is a 5-dodecenoic acid (CHEBI:83044) |
| 5-dodecenoate (CHEBI:83046) is conjugate base of 5-dodecenoic acid (CHEBI:83044) |
| IUPAC Name |
|---|
| dodec-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000529 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23013493 | Reaxys |
| Citations |
|---|