EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42NO5 |
| Net Charge | -1 |
| Average Mass | 448.624 |
| Monoisotopic Mass | 448.30685 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)NCC(=O)[O-])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C26H43NO5/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/p-1/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1 |
| InChIKey | WVULKSPCQVQLCU-BUXLTGKBSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycodeoxycholate (CHEBI:82982) has role human metabolite (CHEBI:77746) |
| glycodeoxycholate (CHEBI:82982) is a N-acylglycinate (CHEBI:57670) |
| glycodeoxycholate (CHEBI:82982) is conjugate base of glycodeoxycholic acid (CHEBI:27471) |
| Incoming Relation(s) |
| sodium glycodeoxycholate (CHEBI:87819) has part glycodeoxycholate (CHEBI:82982) |
| glycodeoxycholic acid (CHEBI:27471) is conjugate acid of glycodeoxycholate (CHEBI:82982) |
| IUPAC Name |
|---|
| {[(3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl]amino}acetate |
| UniProt Name | Source |
|---|---|
| glycodeoxycholate | UniProt |