EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO5 |
| Net Charge | 0 |
| Average Mass | 449.632 |
| Monoisotopic Mass | 449.31412 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)NCC(=O)O)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C26H43NO5/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-/m1/s1 |
| InChIKey | WVULKSPCQVQLCU-BUXLTGKBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycodeoxycholic acid (CHEBI:27471) has functional parent deoxycholic acid (CHEBI:28834) |
| glycodeoxycholic acid (CHEBI:27471) has role human metabolite (CHEBI:77746) |
| glycodeoxycholic acid (CHEBI:27471) is a bile acid glycine conjugate (CHEBI:36255) |
| glycodeoxycholic acid (CHEBI:27471) is conjugate acid of glycodeoxycholate (CHEBI:82982) |
| Incoming Relation(s) |
| 7-oxoglycodeoxycholic acid (CHEBI:138394) has functional parent glycodeoxycholic acid (CHEBI:27471) |
| glycodeoxycholic acid 3-sulfate (CHEBI:133678) has functional parent glycodeoxycholic acid (CHEBI:27471) |
| glycodeoxycholic acid glucuronide (CHEBI:233537) has functional parent glycodeoxycholic acid (CHEBI:27471) |
| glycodeoxycholic acid-2,2,4,4-d4 (CHEBI:192784) is a glycodeoxycholic acid (CHEBI:27471) |
| glycodeoxycholate (CHEBI:82982) is conjugate base of glycodeoxycholic acid (CHEBI:27471) |
| IUPAC Name |
|---|
| N-(3α,12α-dihydroxy-5β-cholan-24-oyl)glycine |
| Synonyms | Source |
|---|---|
| Glycodeoxycholate | KEGG COMPOUND |
| glycodeoxycholic acid | ChemIDplus |
| glycodesoxycholic acid | ChemIDplus |
| deoxycholylglycine | ChemIDplus |
| deoxycholic acid glycine conjugate | ChemIDplus |
| GDCA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05464 | KEGG COMPOUND |
| GLYCODEOXYCHOLIC_ACID | MetaCyc |
| LMST05030006 | LIPID MAPS |
| Glycodeoxycholic_acid | Wikipedia |
| HMDB0000631 | HMDB |
| LSM-5760 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2954947 | Beilstein |
| Reaxys:2954947 | Reaxys |
| CAS:360-65-6 | ChemIDplus |
| Citations |
|---|