EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CCC(CO)C(=O)O |
| InChI | InChI=1S/C5H10O3/c1-2-4(3-6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | ZMZQVAUJTDKQGE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (1016232) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylhydracrylic acid (CHEBI:82956) has role human metabolite (CHEBI:77746) |
| 2-ethylhydracrylic acid (CHEBI:82956) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 2-ethylhydracrylic acid (CHEBI:82956) is a hydroxy fatty acid (CHEBI:24654) |
| 2-ethylhydracrylic acid (CHEBI:82956) is a short-chain fatty acid (CHEBI:26666) |
| 2-ethylhydracrylic acid (CHEBI:82956) is conjugate acid of 2-ethylhydracrylate (CHEBI:82955) |
| Incoming Relation(s) |
| 2-ethylhydracrylate (CHEBI:82955) is conjugate base of 2-ethylhydracrylic acid (CHEBI:82956) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)butanoic acid |
| Synonyms | Source |
|---|---|
| 2-Ethylhydracrylic acid | HMDB |
| 2-(Hydroxymethyl)-Butyric acid | HMDB |
| 3-Hydroxy-2-ethylpropanoic acid | HMDB |
| beta-Hydroxy-alpha-ethylpropionic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000396 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1747119 | Reaxys |
| CAS:4374-62-3 | ChemIDplus |
| Citations |
|---|