EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O3 |
| Net Charge | -1 |
| Average Mass | 117.124 |
| Monoisotopic Mass | 117.05572 |
| SMILES | CCC(CO)C(=O)[O-] |
| InChI | InChI=1S/C5H10O3/c1-2-4(3-6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | ZMZQVAUJTDKQGE-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylhydracrylate (CHEBI:82955) has role human metabolite (CHEBI:77746) |
| 2-ethylhydracrylate (CHEBI:82955) is a hydroxy fatty acid anion (CHEBI:59835) |
| 2-ethylhydracrylate (CHEBI:82955) is conjugate base of 2-ethylhydracrylic acid (CHEBI:82956) |
| Incoming Relation(s) |
| 2-ethylhydracrylic acid (CHEBI:82956) is conjugate acid of 2-ethylhydracrylate (CHEBI:82955) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)butanoate |
| Synonyms | Source |
|---|---|
| 3-hydroxy-2-ethylpropionate | ChEBI |
| 2-(hydroxymethyl)butyrate | ChEBI |
| 3-hydroxy-2-ethylpropanoate | ChEBI |