EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N3O9PS |
| Net Charge | 0 |
| Average Mass | 585.616 |
| Monoisotopic Mass | 585.19099 |
| SMILES | CC(C)CN(C[C@@H](OP(=O)(O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H36N3O9PS/c1-18(2)15-28(39(33,34)22-10-8-20(26)9-11-22)16-24(37-38(30,31)32)23(14-19-6-4-3-5-7-19)27-25(29)36-21-12-13-35-17-21/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29)(H2,30,31,32)/t21-,23-,24+/m0/s1 |
| InChIKey | MLBVMOWEQCZNCC-OEMFJLHTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosamprenavir (CHEBI:82941) has functional parent sulfanilamide (CHEBI:45373) |
| fosamprenavir (CHEBI:82941) has role anti-HIV agent (CHEBI:64946) |
| fosamprenavir (CHEBI:82941) has role antiviral agent (CHEBI:22587) |
| fosamprenavir (CHEBI:82941) has role prodrug (CHEBI:50266) |
| fosamprenavir (CHEBI:82941) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| (3S)-tetrahydrofuran-3-yl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-1-phenyl-3-(phosphonooxy)butan-2-yl]carbamate |
| INN | Source |
|---|---|
| fosamprenavir | ChemIDplus |
| Synonyms | Source |
|---|---|
| FOS-APV | ChemIDplus |
| GW433908A | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1240 | DrugCentral |
| D02497 | KEGG DRUG |
| DB01319 | DrugBank |
| Fosamprenavir | Wikipedia |
| HMDB0015416 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9824450 | Reaxys |
| CAS:226700-79-4 | ChemIDplus |
| Citations |
|---|