EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10NO2 |
| Net Charge | -1 |
| Average Mass | 188.206 |
| Monoisotopic Mass | 188.07170 |
| SMILES | O=C([O-])CCc1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14)/p-1 |
| InChIKey | GOLXRNDWAUTYKT-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1H-indol-3-yl)propanoate (CHEBI:82916) has role human metabolite (CHEBI:77746) |
| 3-(1H-indol-3-yl)propanoate (CHEBI:82916) is a monocarboxylic acid anion (CHEBI:35757) |
| 3-(1H-indol-3-yl)propanoate (CHEBI:82916) is conjugate base of 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) |
| Incoming Relation(s) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) is conjugate acid of 3-(1H-indol-3-yl)propanoate (CHEBI:82916) |
| IUPAC Name |
|---|
| 3-(1H-indol-3-yl)propanoate |
| Synonyms | Source |
|---|---|
| indole-3-propionate | ChEBI |
| indolepropionate | ChEBI |
| UniProt Name | Source |
|---|---|
| indole-3-propanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3907068 | Reaxys |