EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO2 |
| Net Charge | 0 |
| Average Mass | 189.214 |
| Monoisotopic Mass | 189.07898 |
| SMILES | O=C(O)CCc1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) |
| InChIKey | GOLXRNDWAUTYKT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek αυξανω, "to grow"). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has functional parent propionic acid (CHEBI:30768) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role auxin (CHEBI:22676) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role human metabolite (CHEBI:77746) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role plant metabolite (CHEBI:76924) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) is conjugate acid of 3-(1H-indol-3-yl)propanoate (CHEBI:82916) |
| Incoming Relation(s) |
| 3-(1H-indol-3-yl)propanoate (CHEBI:82916) is conjugate base of 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) |
| IUPAC Name |
|---|
| 3-(1H-indol-3-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| beta-(3-Indolyl)propionic acid | ChemIDplus |
| Indole-3-propionic acid | ChemIDplus |
| Indolepropionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002302 | HMDB |
| IOP | PDBeChem |
| Citations |
|---|