EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4S |
| Net Charge | 0 |
| Average Mass | 414.527 |
| Monoisotopic Mass | 414.16133 |
| SMILES | COc1ccc([C@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-15(25)28-20-21(16-9-11-17(27-4)12-10-16)29-19-8-6-5-7-18(19)24(22(20)26)14-13-23(2)3/h5-12,20-21H,13-14H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | HSUGRBWQSSZJOP-LEWJYISDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-diltiazem (CHEBI:82813) has role potassium channel blocker (CHEBI:50509) |
| ent-diltiazem (CHEBI:82813) is a 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate (CHEBI:82814) |
| ent-diltiazem (CHEBI:82813) is conjugate base of ent-diltiazem(1+) (CHEBI:82816) |
| ent-diltiazem (CHEBI:82813) is enantiomer of diltiazem (CHEBI:101278) |
| Incoming Relation(s) |
| ent-diltiazem(1+) (CHEBI:82816) is conjugate acid of ent-diltiazem (CHEBI:82813) |
| diltiazem (CHEBI:101278) is enantiomer of ent-diltiazem (CHEBI:82813) |
| IUPAC Name |
|---|
| (2R,3R)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate |
| Synonyms | Source |
|---|---|
| l-cis-diltiazem | ChEBI |
| (−)-cis-diltiazem | ChEBI |
| L-cis-diltiazem | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-3819 | LINCS |
| Citations |
|---|