EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4S |
| Net Charge | 0 |
| Average Mass | 414.527 |
| Monoisotopic Mass | 414.16133 |
| SMILES | COc1ccc([C@@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-15(25)28-20-21(16-9-11-17(27-4)12-10-16)29-19-8-6-5-7-18(19)24(22(20)26)14-13-23(2)3/h5-12,20-21H,13-14H2,1-4H3/t20-,21+/m1/s1 |
| InChIKey | HSUGRBWQSSZJOP-RTWAWAEBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diltiazem (CHEBI:101278) has role antihypertensive agent (CHEBI:35674) |
| diltiazem (CHEBI:101278) has role calcium channel blocker (CHEBI:38215) |
| diltiazem (CHEBI:101278) has role vasodilator agent (CHEBI:35620) |
| diltiazem (CHEBI:101278) is a 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate (CHEBI:82814) |
| diltiazem (CHEBI:101278) is conjugate base of diltiazem(1+) (CHEBI:82812) |
| diltiazem (CHEBI:101278) is enantiomer of ent-diltiazem (CHEBI:82813) |
| Incoming Relation(s) |
| diltiazem(1+) (CHEBI:82812) is conjugate acid of diltiazem (CHEBI:101278) |
| ent-diltiazem (CHEBI:82813) is enantiomer of diltiazem (CHEBI:101278) |
| IUPAC Name |
|---|
| (2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate |
| INNs | Source |
|---|---|
| diltiazem | WHO MedNet |
| diltiazem | WHO MedNet |
| diltiazem | ChemIDplus |
| diltiazemum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S-cis)-3-(acetyloxy)-5-[2-(dimethylamino)ethyl]-2,3-dihydro-2-(4-methoxyphenyl)-1,5-benzothiazepin-4(5H)-one | ChEBI |
| (2S,3S)-5-(2-(dimethylamino)ethyl)-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl acetate | ChEMBL |
| Acetic acid (2S,3S)-5-(2-dimethylamino-ethyl)-2-(4-methoxy-phenyl)-4-oxo-2,3,4,5-tetrahydro-benzo[b][1,4]thiazepin-3-yl ester | ChEMBL |
| (+)-cis-5-[2-(dimethylamino)ethyl]-2,3-dihydro-3-hydroxy-2-(p-methoxyphenyl)-1,5-benzothiazepin-4(5H)-one acetate ester | ChEBI |
| d-cis-diltiazem | ChEBI |
| D-cis-diltiazem | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3573079 | Reaxys |
| CAS:42399-41-7 | KEGG COMPOUND |
| CAS:42399-41-7 | ChemIDplus |
| CAS:42399-41-7 | NIST Chemistry WebBook |
| Citations |
|---|