EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO4 |
| Net Charge | 0 |
| Average Mass | 279.336 |
| Monoisotopic Mass | 279.14706 |
| SMILES | COCC(=O)N(c1c(C)cccc1C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m0/s1 |
| InChIKey | ZQEIXNIJLIKNTD-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-metalaxyl (CHEBI:82791) is a L-alanine derivative (CHEBI:83943) |
| (S)-metalaxyl (CHEBI:82791) is a methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CHEBI:82790) |
| (S)-metalaxyl (CHEBI:82791) is enantiomer of metalaxyl-M (CHEBI:60607) |
| Incoming Relation(s) |
| metalaxyl (CHEBI:6790) has part (S)-metalaxyl (CHEBI:82791) |
| metalaxyl-M (CHEBI:60607) is enantiomer of (S)-metalaxyl (CHEBI:82791) |
| IUPAC Name |
|---|
| methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-L-alaninate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8324516 | Reaxys |