EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO4 |
| Net Charge | 0 |
| Average Mass | 279.336 |
| Monoisotopic Mass | 279.14706 |
| SMILES | COCC(=O)N(c1c(C)cccc1C)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |
| InChIKey | ZQEIXNIJLIKNTD-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metalaxyl-M (CHEBI:60607) has functional parent D-alanine (CHEBI:15570) |
| metalaxyl-M (CHEBI:60607) has role agrochemical (CHEBI:33286) |
| metalaxyl-M (CHEBI:60607) is a D-alanine derivative (CHEBI:83944) |
| metalaxyl-M (CHEBI:60607) is a acylamino acid fungicide (CHEBI:87013) |
| metalaxyl-M (CHEBI:60607) is a anilide fungicide (CHEBI:87015) |
| metalaxyl-M (CHEBI:60607) is a methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CHEBI:82790) |
| metalaxyl-M (CHEBI:60607) is enantiomer of (S)-metalaxyl (CHEBI:82791) |
| Incoming Relation(s) |
| metalaxyl (CHEBI:6790) has part metalaxyl-M (CHEBI:60607) |
| (S)-metalaxyl (CHEBI:82791) is enantiomer of metalaxyl-M (CHEBI:60607) |
| IUPAC Name |
|---|
| methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-D-alaninate |
| Synonyms | Source |
|---|---|
| (−)-metalaxyl | ChemIDplus |
| methyl N-(methoxyacetyl)-N-(2,6-xylyl)-D-alaninate | ChemIDplus |
| (R)-N-(2,6-dimethylphenyl)-N-(methoxyacetylamino)propionic acid methyl ester | ChEBI |
| methyl (R)-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate | ChEBI |
| R-metalaxyl | ChEBI |
| (R)-metalaxyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18626 | KEGG COMPOUND |
| WO2011012493 | Patent |
| metalaxyl-m | Alan Wood's Pesticides |
| 445 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5081553 | Reaxys |
| CAS:70630-17-0 | ChemIDplus |
| CAS:70630-17-0 | KEGG COMPOUND |
| Citations |
|---|