EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H48ClN3O10S |
| Net Charge | 0 |
| Average Mass | 738.300 |
| Monoisotopic Mass | 737.27489 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(=O)CCS)CC(=O)N(C)c1cc(cc(OC)c1Cl)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@]([H])(OC(=O)N1)[C@H]2C |
| InChI | InChI=1S/C35H48ClN3O10S/c1-19-10-9-11-26(46-8)35(44)18-25(47-33(43)37-35)20(2)31-34(4,49-31)27(48-32(42)21(3)38(5)28(40)12-13-50)17-29(41)39(6)23-15-22(14-19)16-24(45-7)30(23)36/h9-11,15-16,20-21,25-27,31,44,50H,12-14,17-18H2,1-8H3,(H,37,43)/b11-9+,19-10+/t20-,21+,25+,26-,27+,31+,34+,35+/m1/s1 |
| InChIKey | ANZJBCHSOXCCRQ-FKUXLPTCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mertansine (CHEBI:82755) has functional parent maytansine (CHEBI:6701) |
| mertansine (CHEBI:82755) has role antineoplastic agent (CHEBI:35610) |
| mertansine (CHEBI:82755) has role tubulin modulator (CHEBI:60832) |
| mertansine (CHEBI:82755) is a carbamate ester (CHEBI:23003) |
| mertansine (CHEBI:82755) is a epoxide (CHEBI:32955) |
| mertansine (CHEBI:82755) is a maytansinoid (CHEBI:82760) |
| mertansine (CHEBI:82755) is a organic heterotetracyclic compound (CHEBI:38163) |
| mertansine (CHEBI:82755) is a organochlorine compound (CHEBI:36683) |
| mertansine (CHEBI:82755) is a thiol (CHEBI:29256) |
| mertansine (CHEBI:82755) is a α-amino acid ester (CHEBI:46874) |
| Synonyms | Source |
|---|---|
| maytansinoid DM 1 | ChemIDplus |
| DM1 | ChemIDplus |
| DM 1 | ChemIDplus |
| maytansinoid DM1 | ChEBI |
| N2'-deacetyl-N2'-(3-mercapto-1-oxopropyl)-maytansine | ChEBI |
| (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10(26),11,13,16,18-pentaen-6-yl (2S)-2-[methyl(3-sulfanylpropanoyl)amino]propanoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Mertansine | Wikipedia |
| C20259 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10753281 | Reaxys |
| CAS:139504-50-0 | ChemIDplus |
| Citations |
|---|