EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46ClN3O10 |
| Net Charge | 0 |
| Average Mass | 692.206 |
| Monoisotopic Mass | 691.28717 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N(C)c1cc(cc(OC)c1Cl)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@]([H])(OC(=O)N1)[C@H]2C |
| InChI | InChI=1S/C34H46ClN3O10/c1-18-11-10-12-26(45-9)34(43)17-25(46-32(42)36-34)19(2)30-33(5,48-30)27(47-31(41)20(3)37(6)21(4)39)16-28(40)38(7)23-14-22(13-18)15-24(44-8)29(23)35/h10-12,14-15,19-20,25-27,30,43H,13,16-17H2,1-9H3,(H,36,42)/b12-10+,18-11+/t19-,20+,25+,26-,27+,30+,33+,34+/m1/s1 |
| InChIKey | WKPWGQKGSOKKOO-RSFHAFMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maytansine (CHEBI:6701) has role antimicrobial agent (CHEBI:33281) |
| maytansine (CHEBI:6701) has role antimitotic (CHEBI:64911) |
| maytansine (CHEBI:6701) has role antineoplastic agent (CHEBI:35610) |
| maytansine (CHEBI:6701) has role plant metabolite (CHEBI:76924) |
| maytansine (CHEBI:6701) has role tubulin modulator (CHEBI:60832) |
| maytansine (CHEBI:6701) is a carbamate ester (CHEBI:23003) |
| maytansine (CHEBI:6701) is a epoxide (CHEBI:32955) |
| maytansine (CHEBI:6701) is a maytansinoid (CHEBI:82760) |
| maytansine (CHEBI:6701) is a organic heterotetracyclic compound (CHEBI:38163) |
| maytansine (CHEBI:6701) is a organochlorine compound (CHEBI:36683) |
| maytansine (CHEBI:6701) is a α-amino acid ester (CHEBI:46874) |
| Incoming Relation(s) |
| mertansine (CHEBI:82755) has functional parent maytansine (CHEBI:6701) |
| IUPAC Name |
|---|
| (4β,5β,11E,13E)-maytansine |
| INNs | Source |
|---|---|
| maitansina | WHO MedNet |
| maitansine | WHO MedNet |
| maitansine | WHO MedNet |
| maitansinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Maytansine | KEGG COMPOUND |
| NSC 153858 | ChemIDplus |
| NSC-153858 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002351 | KNApSAcK |
| C10606 | KEGG COMPOUND |
| D04864 | KEGG DRUG |
| LMPK04000017 | LIPID MAPS |
| Maytansine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5417399 | Reaxys |
| CAS:35846-53-8 | ChemIDplus |
| CAS:35846-53-8 | KEGG COMPOUND |
| Citations |
|---|