EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46ClN3O10 |
| Net Charge | 0 |
| Average Mass | 692.206 |
| Monoisotopic Mass | 691.28717 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N(C)c1cc(cc(OC)c1Cl)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@]([H])(OC(=O)N1)[C@H]2C |
| InChI | InChI=1S/C34H46ClN3O10/c1-18-11-10-12-26(45-9)34(43)17-25(46-32(42)36-34)19(2)30-33(5,48-30)27(47-31(41)20(3)37(6)21(4)39)16-28(40)38(7)23-14-22(13-18)15-24(44-8)29(23)35/h10-12,14-15,19-20,25-27,30,43H,13,16-17H2,1-9H3,(H,36,42)/b12-10+,18-11+/t19-,20+,25+,26-,27+,30+,33+,34+/m1/s1 |
| InChIKey | WKPWGQKGSOKKOO-RSFHAFMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimitotic Any compound that inhibits cell division (mitosis). tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maytansine (CHEBI:6701) has role antimicrobial agent (CHEBI:33281) |
| maytansine (CHEBI:6701) has role antimitotic (CHEBI:64911) |
| maytansine (CHEBI:6701) has role antineoplastic agent (CHEBI:35610) |
| maytansine (CHEBI:6701) has role plant metabolite (CHEBI:76924) |
| maytansine (CHEBI:6701) has role tubulin modulator (CHEBI:60832) |
| maytansine (CHEBI:6701) is a carbamate ester (CHEBI:23003) |
| maytansine (CHEBI:6701) is a epoxide (CHEBI:32955) |
| maytansine (CHEBI:6701) is a maytansinoid (CHEBI:82760) |
| maytansine (CHEBI:6701) is a organic heterotetracyclic compound (CHEBI:38163) |
| maytansine (CHEBI:6701) is a organochlorine compound (CHEBI:36683) |
| maytansine (CHEBI:6701) is a α-amino acid ester (CHEBI:46874) |
| Incoming Relation(s) |
| mertansine (CHEBI:82755) has functional parent maytansine (CHEBI:6701) |
| IUPAC Name |
|---|
| (4β,5β,11E,13E)-maytansine |
| INNs | Source |
|---|---|
| maitansina | WHO MedNet |
| maitansine | WHO MedNet |
| maitansine | WHO MedNet |
| maitansinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Maytansine | KEGG COMPOUND |
| NSC 153858 | ChemIDplus |
| NSC-153858 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002351 | KNApSAcK |
| C10606 | KEGG COMPOUND |
| D04864 | KEGG DRUG |
| LMPK04000017 | LIPID MAPS |
| Maytansine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5417399 | Reaxys |
| CAS:35846-53-8 | KEGG COMPOUND |
| CAS:35846-53-8 | ChemIDplus |
| Citations |
|---|