EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H69N18O18PS |
| Net Charge | 0 |
| Average Mass | 1177.163 |
| Monoisotopic Mass | 1176.44955 |
| SMILES | [H]C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)NP(=O)(OCCCN)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)[C@@H](C)O |
| InChI | InChI=1S/C42H69N18O18PS/c1-19(35(69)57-24(13-28(65)66)39(73)59-79(75,76-10-5-8-43)77-15-25-31(67)32(68)41(78-25)60-17-52-30-33(45)50-16-51-34(30)60)54-38(72)23(12-26(44)63)55-27(64)14-49-40(74)29(20(2)62)58-37(71)22(6-4-9-48-42(46)47)56-36(70)21(53-18-61)7-11-80-3/h16-25,29,31-32,41,62,67-68H,4-15,43H2,1-3H3,(H2,44,63)(H,49,74)(H,53,61)(H,54,72)(H,55,64)(H,56,70)(H,57,69)(H,58,71)(H,65,66)(H2,45,50,51)(H4,46,47,48)(H,59,73,75)/t19-,20+,21-,22-,23-,24-,25+,29-,31+,32+,41+,79?/m0/s1 |
| InChIKey | PQZVLCSYKIYYRQ-CRNXWWIHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 6.1.1.12 (aspartate--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that specifically inhibits the action of aspartate—tRNA ligase (EC 6.1.1.12). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microcin c (CHEBI:82754) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| microcin c (CHEBI:82754) has role EC 6.1.1.12 (aspartate—tRNA ligase) inhibitor (CHEBI:82756) |
| microcin c (CHEBI:82754) is a microcin (CHEBI:64627) |
| IUPAC Name |
|---|
| 5'-O-{(3-aminopropoxy)[(N-formyl-L-methionyl-L-arginyl-L-threonylglycyl-L-asparaginyl-L-alanyl-L-α-aspartyl)amino]phosphoryl}adenosine |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1129 | MetaCyc |
| Citations |
|---|