EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O5 |
| Net Charge | 0 |
| Average Mass | 234.207 |
| Monoisotopic Mass | 234.05282 |
| SMILES | COC1=C(C)C(=O)c2c(O)cc(O)cc2C1=O |
| InChI | InChI=1S/C12H10O5/c1-5-10(15)9-7(11(16)12(5)17-2)3-6(13)4-8(9)14/h3-4,13-14H,1-2H3 |
| InChIKey | MMVQTVRCJUHCSV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) has functional parent flaviolin (CHEBI:42646) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) has role bacterial metabolite (CHEBI:76969) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) is a enol ether (CHEBI:47985) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) is a phenols (CHEBI:33853) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) is conjugate acid of 2-O,3-dimethylflaviolin-7-olate (CHEBI:78589) |
| Incoming Relation(s) |
| 2-O,3-dimethylflaviolin-7-olate (CHEBI:78589) is conjugate base of 2-O,3-dimethylflaviolin (CHEBI:82611) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-methoxy-3-methyl-1,4-naphthoquinone |
| Synonym | Source |
|---|---|
| 2-methoxy-3-methylflaviolin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16658 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9564514 | Reaxys |
| Citations |
|---|