EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O5 |
| Net Charge | 0 |
| Average Mass | 206.153 |
| Monoisotopic Mass | 206.02152 |
| SMILES | O=C1C(O)=CC(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C10H6O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h1-3,11-12,14H |
| InChIKey | RROPNRTUMVVUED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flaviolin (CHEBI:42646) has role Aspergillus metabolite (CHEBI:76956) |
| flaviolin (CHEBI:42646) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| flaviolin (CHEBI:42646) is conjugate acid of flaviolin-2-olate (CHEBI:58696) |
| Incoming Relation(s) |
| 2-O,3-dimethylflaviolin (CHEBI:82611) has functional parent flaviolin (CHEBI:42646) |
| 3-linalylflaviolin (CHEBI:79196) has functional parent flaviolin (CHEBI:42646) |
| 3,3'-biflaviolin (CHEBI:51836) has functional parent flaviolin (CHEBI:42646) |
| 3,8'-biflaviolin (CHEBI:51837) has functional parent flaviolin (CHEBI:42646) |
| 6-linalyl-2-O,3-dimethylflaviolin (CHEBI:82610) has functional parent flaviolin (CHEBI:42646) |
| 7-O-geranyl-2-O,3-dimethylflaviolin (CHEBI:78590) has functional parent flaviolin (CHEBI:42646) |
| flaviolin-2-olate (CHEBI:58696) is conjugate base of flaviolin (CHEBI:42646) |
| IUPAC Name |
|---|
| 2,5,7-trihydroxynaphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2,5,7-Trihydroxy-1,4-naphthalenedione | KEGG COMPOUND |
| 4,5,7-trihydroxynaphthalene-1,2-dione | IUBMB |
| FLAVIOLIN | PDBeChem |
| Citations |
|---|