EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:8248 - pirimicarb
| Formula | C11H18N4O2 |
| Net Charge | 0 |
| Average Mass | 238.291 |
| Monoisotopic Mass | 238.14298 |
| SMILES | Cc1nc(N(C)C)nc(OC(=O)N(C)C)c1C |
| InChI | InChI=1S/C11H18N4O2/c1-7-8(2)12-10(14(3)4)13-9(7)17-11(16)15(5)6/h1-6H3 |
| InChIKey | YFGYUFNIOHWBOB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirimicarb (CHEBI:8248) has functional parent dimethylcarbamic acid (CHEBI:38544) |
| pirimicarb (CHEBI:8248) has role agrochemical (CHEBI:33286) |
| pirimicarb (CHEBI:8248) has role carbamate insecticide (CHEBI:38461) |
| pirimicarb (CHEBI:8248) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| pirimicarb (CHEBI:8248) has role environmental contaminant (CHEBI:78298) |
| pirimicarb (CHEBI:8248) has role insecticide (CHEBI:24852) |
| pirimicarb (CHEBI:8248) has role xenobiotic (CHEBI:35703) |
| pirimicarb (CHEBI:8248) is a aminopyrimidine (CHEBI:38338) |
| pirimicarb (CHEBI:8248) is a carbamate ester (CHEBI:23003) |
| pirimicarb (CHEBI:8248) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate |
| Synonyms | Source |
|---|---|
| Dimethylcarbamic acid 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl ester | ChemIDplus |
| Pirimicarb | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 530 | PPDB |
| C11079 | KEGG COMPOUND |
| pirimicarb | Alan Wood's Pesticides |
| Pirimicarb | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:663442 | Reaxys |
| CAS:23103-98-2 | KEGG COMPOUND |
| CAS:23103-98-2 | ChemIDplus |
| Citations |
|---|