EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O3 |
| Net Charge | 0 |
| Average Mass | 118.092 |
| Monoisotopic Mass | 118.03784 |
| SMILES | CN(CC(=O)O)N=O |
| InChI | InChI=1S/C3H6N2O3/c1-5(4-8)2-3(6)7/h2H2,1H3,(H,6,7) |
| InChIKey | HJMPSKKJHVWPBK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitrososarcosine (CHEBI:82363) has functional parent sarcosine (CHEBI:15611) |
| N-nitrososarcosine (CHEBI:82363) has role carcinogenic agent (CHEBI:50903) |
| N-nitrososarcosine (CHEBI:82363) is a nitrosamine (CHEBI:35803) |
| N-nitrososarcosine (CHEBI:82363) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| IUPAC Name |
|---|
| [methyl(nitroso)amino]acetic acid |
| Synonyms | Source |
|---|---|
| N-methyl-N-(carboxymethyl)nitrosamine | ChemIDplus |
| N-methyl-N-nitrosoglycine | ChemIDplus |
| N-nitrosomethylglycine | ChemIDplus |
| Nitroso sarkosin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C19286 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:13256-22-9 | ChemIDplus |
| CAS:13256-22-9 | KEGG COMPOUND |
| Citations |
|---|