EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | CNCC(=O)O |
| InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
| InChIKey | FSYKKLYZXJSNPZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). glycine receptor agonist An agonist that binds to and activates glycine receptors Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. glycine transporter 1 inhibitor Any glycine transporter inhibitor that interferes with the action of glycine 1 transporters. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarcosine (CHEBI:15611) has role Escherichia coli metabolite (CHEBI:76971) |
| sarcosine (CHEBI:15611) has role antidepressant (CHEBI:35469) |
| sarcosine (CHEBI:15611) has role antipsychotic agent (CHEBI:35476) |
| sarcosine (CHEBI:15611) has role glycine receptor agonist (CHEBI:64589) |
| sarcosine (CHEBI:15611) has role glycine transporter 1 inhibitor (CHEBI:64588) |
| sarcosine (CHEBI:15611) has role human metabolite (CHEBI:77746) |
| sarcosine (CHEBI:15611) has role mouse metabolite (CHEBI:75771) |
| sarcosine (CHEBI:15611) is a N-alkylglycine (CHEBI:66933) |
| sarcosine (CHEBI:15611) is a N-methyl-amino acid (CHEBI:21760) |
| sarcosine (CHEBI:15611) is a N-methylglycines (CHEBI:21766) |
| sarcosine (CHEBI:15611) is conjugate acid of sarcosinate (CHEBI:46915) |
| sarcosine (CHEBI:15611) is conjugate base of sarcosinium (CHEBI:46842) |
| sarcosine (CHEBI:15611) is tautomer of sarcosine zwitterion (CHEBI:57433) |
| Incoming Relation(s) |
| N-nitrososarcosine (CHEBI:82363) has functional parent sarcosine (CHEBI:15611) |
| sarcosinium (CHEBI:46842) is conjugate acid of sarcosine (CHEBI:15611) |
| sarcosinate (CHEBI:46915) is conjugate base of sarcosine (CHEBI:15611) |
| sarcosine zwitterion (CHEBI:57433) is tautomer of sarcosine (CHEBI:15611) |
| IUPAC Name |
|---|
| sarcosine |
| Synonyms | Source |
|---|---|
| N-methylaminoacetic acid | NIST Chemistry WebBook |
| L-sarcosine | ChEBI |
| MeGly | ChEBI |
| (methylamino)acetic acid | ChemIDplus |
| methylaminoacetic acid | NIST Chemistry WebBook |
| Methylamino-acetic acid | ChEMBL |
| Citations |
|---|