EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N5O7S.Na |
| Net Charge | 0 |
| Average Mass | 539.546 |
| Monoisotopic Mass | 539.14506 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C23H27N5O7S.Na/c1-4-26-10-11-27(19(32)18(26)31)22(35)25-13(12-8-6-5-7-9-12)16(29)24-14-17(30)28-15(21(33)34)23(2,3)36-20(14)28;/h5-9,13-15,20H,4,10-11H2,1-3H3,(H,24,29)(H,25,35)(H,33,34);/q;+1/p-1/t13-,14-,15+,20-;/m1./s1 |
| InChIKey | WCMIIGXFCMNQDS-IDYPWDAWSA-M |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperacillin sodium (CHEBI:8233) has part piperacillin(1−) (CHEBI:52433) |
| piperacillin sodium (CHEBI:8233) has role anti-inflammatory agent (CHEBI:67079) |
| piperacillin sodium (CHEBI:8233) has role antibacterial agent (CHEBI:33282) |
| piperacillin sodium (CHEBI:8233) has role antiinfective agent (CHEBI:35441) |
| piperacillin sodium (CHEBI:8233) has role antimicrobial agent (CHEBI:33281) |
| piperacillin sodium (CHEBI:8233) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 6β-{(2R)-2-[(4-ethyl-2,3-dioxopiperazin-1-yl)carboxamido]-2-phenylacetamido}-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| CL 227,193 | ChEMBL |
| CL-227193 | ChEMBL |
| NSC-757277 | ChEMBL |
| Penmalin | ChEMBL |
| Piperacillin (as sodium) | ChEMBL |
| Piperacillin sodium | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Piperacillin sodium component of zosyn | ChEMBL |
| Pipril | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5373920 | Beilstein |
| CAS:59703-84-3 | ChemIDplus |
| CAS:59703-84-3 | KEGG COMPOUND |
| Citations |
|---|