EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N5O7S |
| Net Charge | -1 |
| Average Mass | 516.556 |
| Monoisotopic Mass | 516.15584 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N5O7S/c1-4-26-10-11-27(19(32)18(26)31)22(35)25-13(12-8-6-5-7-9-12)16(29)24-14-17(30)28-15(21(33)34)23(2,3)36-20(14)28/h5-9,13-15,20H,4,10-11H2,1-3H3,(H,24,29)(H,25,35)(H,33,34)/p-1/t13-,14-,15+,20-/m1/s1 |
| InChIKey | IVBHGBMCVLDMKU-GXNBUGAJSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperacillin(1−) (CHEBI:52433) is a penicillinate anion (CHEBI:51356) |
| piperacillin(1−) (CHEBI:52433) is conjugate base of piperacillin (CHEBI:8232) |
| Incoming Relation(s) |
| piperacillin sodium (CHEBI:8233) has part piperacillin(1−) (CHEBI:52433) |
| piperacillin (CHEBI:8232) is conjugate acid of piperacillin(1−) (CHEBI:52433) |
| IUPAC Name |
|---|
| 6β-{(2R)-2-[(4-ethyl-2,3-dioxopiperazin-1-yl)carboxamido]-2-phenylacetamido}-2,2-dimethylpenam-3α-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5369991 | Beilstein |