EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O2 |
| Net Charge | 0 |
| Average Mass | 248.326 |
| Monoisotopic Mass | 248.15248 |
| SMILES | CC(C)NCC(O)COc1cccc2nccc12 |
| InChI | InChI=1S/C14H20N2O2/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13/h3-7,10-11,15-17H,8-9H2,1-2H3 |
| InChIKey | JZQKKSLKJUAGIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pindolol (CHEBI:8214) has role antiglaucoma drug (CHEBI:39456) |
| pindolol (CHEBI:8214) has role antihypertensive agent (CHEBI:35674) |
| pindolol (CHEBI:8214) has role serotonergic antagonist (CHEBI:48279) |
| pindolol (CHEBI:8214) has role vasodilator agent (CHEBI:35620) |
| pindolol (CHEBI:8214) has role β-adrenergic antagonist (CHEBI:35530) |
| pindolol (CHEBI:8214) is a indoles (CHEBI:24828) |
| pindolol (CHEBI:8214) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| (R)-(+)-pindolol (CHEBI:48280) is a pindolol (CHEBI:8214) |
| (S)-(−)-pindolol (CHEBI:48281) is a pindolol (CHEBI:8214) |
| IUPAC Name |
|---|
| 1-(1H-indol-4-yloxy)-3-[(propan-2-yl)amino]propan-2-ol |
| INNs | Source |
|---|---|
| pindolol | ChemIDplus |
| pindololum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(1H-indol-4-yloxy)-3-[(1-methylethyl)amino]propan-2-ol | IUPAC |
| 1-(1H-indol-4-yloxy)-3-(isopropylamino)propan-2-ol | IUPAC |
| 1-(1H-indol-4-yloxy)-3-(propan-2-ylamino)-propan-2-ol | IUPHAR |
| 4-(2-hydroxy-3-isopropylaminopropoxy)-indole | ChemIDplus |
| pindolol | IUPHAR |
| pindolol | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Betapindol | DrugBank |
| Blockin L | DrugBank |
| Blocklin L | DrugBank |
| Blocklin-L | KEGG DRUG |
| Calvisken | DrugBank |
| Cardilate | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1536506 | Reaxys |
| CAS:13523-86-9 | NIST Chemistry WebBook |
| CAS:13523-86-9 | KEGG COMPOUND |
| CAS:13523-86-9 | ChemIDplus |
| Citations |
|---|