EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O2 |
| Net Charge | 0 |
| Average Mass | 208.261 |
| Monoisotopic Mass | 208.12118 |
| SMILES | CC[C@@H]1C(=O)OC[C@@H]1Cc1cncn1C |
| InChI | InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | QCHFTSOMWOSFHM-WPRPVWTQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-pilocarpine (CHEBI:8207) has role antiglaucoma drug (CHEBI:39456) |
| (+)-pilocarpine (CHEBI:8207) is a pilocarpine (CHEBI:39462) |
| (+)-pilocarpine (CHEBI:8207) is enantiomer of (−)-pilocarpine (CHEBI:39464) |
| Incoming Relation(s) |
| pilocarpine hydrochloride (CHEBI:141029) has part (+)-pilocarpine (CHEBI:8207) |
| (−)-pilocarpine (CHEBI:39464) is enantiomer of (+)-pilocarpine (CHEBI:8207) |
| IUPAC Name |
|---|
| (3S,4R)-3-ethyl-4-[(1-methyl-1H-imidazol-5-yl)methyl]dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (3S,4R)-3-ethyldihydro-4-((1-methyl-1H-imidazol-5-yl)methyl)-2(3H)-furanone | ChemIDplus |
| (3S-cis)-3-ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-2(3H)-furanone | NIST Chemistry WebBook |
| (+)-pilocarpine | NIST Chemistry WebBook |
| Pilocarpine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2166 | DrugCentral |
| C00002355 | KNApSAcK |
| C07474 | KEGG COMPOUND |
| D00525 | KEGG DRUG |
| HMDB0015217 | HMDB |
| LSM-5909 | LINCS |
| Pilocarpine | Wikipedia |
| Citations |
|---|