EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 244.722 |
| Monoisotopic Mass | 244.09786 |
| SMILES | CC[C@@H]1C(=O)OC[C@@H]1Cc1cncn1C.Cl |
| InChI | InChI=1S/C11H16N2O2.ClH/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;/h5,7-8,10H,3-4,6H2,1-2H3;1H/t8-,10-;/m0./s1 |
| InChIKey | RNAICSBVACLLGM-GNAZCLTHSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pilocarpine hydrochloride (CHEBI:141029) has part (+)-pilocarpine (CHEBI:8207) |
| pilocarpine hydrochloride (CHEBI:141029) has role antineoplastic agent (CHEBI:35610) |
| pilocarpine hydrochloride (CHEBI:141029) has role ophthalmology drug (CHEBI:66981) |
| pilocarpine hydrochloride (CHEBI:141029) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3S,4R)-3-ethyl-4-[(1-methyl-1H-imidazol-5-yl)methyl]dihydrofuran-2(3H)-one hydrochloride |
| Synonyms | Source |
|---|---|
| Pilocarpine HCl | ChemIDplus |
| (+)-pilocarpine hydrochloride | ChEBI |
| Pilocarpine hydrochloride | ChEMBL |
| Pilocarpine monohydrochloride | ChemIDplus |
| Pilocarpini hydrochloridum | ChEMBL |
| Pilocarpinum muriaticum | ChEMBL |
| Brand Names | Source |
|---|---|
| Isopto carpine | ChEMBL |
| Ocusert | ChEMBL |
| Pilocarpine hydrochloride component of betoptic pilo | ChEMBL |
| Piloc hcl | ChEMBL |
| Pilogel | ChEMBL |
| Pilopine | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5364331 | Reaxys |
| CAS:54-71-7 | ChemIDplus |
| Citations |
|---|