EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13ClFN3O3S2 |
| Net Charge | 0 |
| Average Mass | 389.861 |
| Monoisotopic Mass | 389.00709 |
| SMILES | O=C(O)CSc1cc(N=c2sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C14H13ClFN3O3S2/c15-8-5-9(16)10(6-11(8)23-7-12(20)21)17-13-18-3-1-2-4-19(18)14(22)24-13/h5-6H,1-4,7H2,(H,20,21) |
| InChIKey | XWROTTLWMHCFEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluthiacet (CHEBI:82018) has role agrochemical (CHEBI:33286) |
| fluthiacet (CHEBI:82018) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| fluthiacet (CHEBI:82018) has role herbicide (CHEBI:24527) |
| fluthiacet (CHEBI:82018) is a monocarboxylic acid (CHEBI:25384) |
| fluthiacet (CHEBI:82018) is a monochlorobenzenes (CHEBI:83403) |
| fluthiacet (CHEBI:82018) is a monofluorobenzenes (CHEBI:83575) |
| fluthiacet (CHEBI:82018) is a organic sulfide (CHEBI:16385) |
| fluthiacet (CHEBI:82018) is a thiadiazolopyridazine (CHEBI:48874) |
| Incoming Relation(s) |
| fluthiacet-methyl (CHEBI:5133) has functional parent fluthiacet (CHEBI:82018) |
| IUPAC Name |
|---|
| [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxotetrahydro[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)thio]acetic acid |
| Synonyms | Source |
|---|---|
| {2-chloro-4-fluoro-5-[(EZ)-5,6,7,8-tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylideneamino]phenylthio}acetic acid | Alan Wood's Pesticides |
| 2-[[2-chloro-4-fluoro-5-[(tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]thio]acetic acid | Alan Wood's Pesticides |
| [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxo-5,6,7,8-tetrahydro-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)sulfanyl]acetic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C18859 | KEGG COMPOUND |
| fluthiacet | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30957442 | Reaxys |
| CAS:149253-65-6 | KEGG COMPOUND |
| CAS:149253-65-6 | Alan Wood's Pesticides |
| CAS:149253-65-6 | ChemIDplus |