EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15ClFN3O3S2 |
| Net Charge | 0 |
| Average Mass | 403.888 |
| Monoisotopic Mass | 403.02274 |
| SMILES | COC(=O)CSc1cc(N=c2sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C15H15ClFN3O3S2/c1-23-13(21)8-24-12-7-11(10(17)6-9(12)16)18-14-19-4-2-3-5-20(19)15(22)25-14/h6-7H,2-5,8H2,1H3 |
| InChIKey | ZCNQYNHDVRPZIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluthiacet-methyl (CHEBI:5133) has functional parent fluthiacet (CHEBI:82018) |
| fluthiacet-methyl (CHEBI:5133) has role agrochemical (CHEBI:33286) |
| fluthiacet-methyl (CHEBI:5133) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| fluthiacet-methyl (CHEBI:5133) has role proherbicide (CHEBI:136646) |
| fluthiacet-methyl (CHEBI:5133) is a methyl ester (CHEBI:25248) |
| fluthiacet-methyl (CHEBI:5133) is a monochlorobenzenes (CHEBI:83403) |
| fluthiacet-methyl (CHEBI:5133) is a monofluorobenzenes (CHEBI:83575) |
| fluthiacet-methyl (CHEBI:5133) is a organic sulfide (CHEBI:16385) |
| fluthiacet-methyl (CHEBI:5133) is a thiadiazolopyridazine (CHEBI:48874) |
| IUPAC Name |
|---|
| methyl [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxotetrahydro[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)thio]acetate |
| Synonyms | Source |
|---|---|
| methyl {2-chloro-4-fluoro-5-[(EZ)-5,6,7,8-tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylideneamino]phenylthio}acetate | Alan Wood's Pesticides |
| methyl 2-[[2-chloro-4-fluoro-5-[(tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]thio]acetate | Alan Wood's Pesticides |
| methyl [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxo-5,6,7,8-tetrahydro-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)sulfanyl]acetate | Alan Wood's Pesticides |
| CGA 248757 | ChemIDplus |
| KIH 9201 | ChemIDplus |
| CGA-248757 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Action | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10908 | KEGG COMPOUND |
| derivatives/fluthiacet-methyl | Alan Wood's Pesticides |
| EP273417 | Patent |
| US4906279 | Patent |
| 1499 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11510131 | Reaxys |
| CAS:117337-19-6 | KEGG COMPOUND |
| CAS:117337-19-6 | Alan Wood's Pesticides |
| CAS:117337-19-6 | ChemIDplus |
| Citations |
|---|